C19H20 — CID 162529967
(2Z)-10-ethyltricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,13,15-heptaene (PubChem CID 162529967) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2Z)-10-ethyltricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,13,15-heptaene.
| Compound Name | (2Z)-10-ethyltricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,13,15-heptaene |
|---|---|
| PubChem CID | 162529967 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (2Z)-10-ethyltricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,13,15-heptaene |
| SMILES | CCC1CCc2ccccc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C19H20/c1-2-15-11-12-16-7-3-4-8-17(16)13-14-18-9-5-6-10-19(15)18/h3-10,13-15H,2,11-12H2,1H3/b14-13- |
| InChIKey | QRHVNSKCJXBGSS-YPKPFQOOSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|