C17H16 — CID 145199366
(2Z)-tricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,13,15-heptaene (PubChem CID 145199366) has the molecular formula C17H16 and a molecular weight of 220.32 g/mol. Its IUPAC name is (2Z)-tricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,13,15-heptaene.
| Compound Name | (2Z)-tricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,13,15-heptaene |
|---|---|
| PubChem CID | 145199366 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2Z)-tricyclo[11.4.0.04,9]heptadeca-1(17),2,4,6,8,13,15-heptaene |
| SMILES | C1=C\c2ccccc2CCCc2ccccc2/1 |
| InChI | InChI=1S/C17H16/c1-3-8-16-12-13-17-9-4-2-7-15(17)11-5-10-14(16)6-1/h1-4,6-9,12-13H,5,10-11H2/b13-12- |
| InChIKey | JQFAUFSBDHCJGT-SEYXRHQNSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|