C14H18 — CID 134982097
(5E)-7,8,9,10,11,12-hexahydrobenzo[10]annulene (PubChem CID 134982097) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is (5E)-7,8,9,10,11,12-hexahydrobenzo[10]annulene.
| Compound Name | (5E)-7,8,9,10,11,12-hexahydrobenzo[10]annulene |
|---|---|
| PubChem CID | 134982097 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (5E)-7,8,9,10,11,12-hexahydrobenzo[10]annulene |
| SMILES | C1=C/c2ccccc2CCCCCC/1 |
| InChI | InChI=1S/C14H18/c1-2-4-6-10-14-12-8-7-11-13(14)9-5-3-1/h5,7-9,11-12H,1-4,6,10H2/b9-5+ |
| InChIKey | GLZWOBGHHUWGLQ-WEVVVXLNSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |