C10H10Cl3OP — CID 91096847
1,2-dihydronaphthalene;phosphoryl trichloride (PubChem CID 91096847) has the molecular formula C10H10Cl3OP and a molecular weight of 283.52 g/mol. Its IUPAC name is 1,2-dihydronaphthalene;phosphoryl trichloride.
| Compound Name | 1,2-dihydronaphthalene;phosphoryl trichloride |
|---|---|
| PubChem CID | 91096847 |
| Molecular Formula | C10H10Cl3OP |
| Molecular Weight | 283.52 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 1,2-dihydronaphthalene;phosphoryl trichloride |
| SMILES | C1=Cc2ccccc2CC1.O=P(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10.Cl3OP/c1-2-6-10-8-4-3-7-9(10)5-1;1-5(2,3)4/h1-3,5-7H,4,8H2; |
| InChIKey | DWIZASMGJNSXEK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|