About 1,2-dihydronaphthalene;1,3-thiazole
1,2-dihydronaphthalene;1,3-thiazole (PubChem CID 68836302) has the molecular formula C13H13NS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 1,2-dihydronaphthalene;1,3-thiazole.
Molecular Properties
| Compound Name | 1,2-dihydronaphthalene;1,3-thiazole |
| PubChem CID | 68836302 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 1,2-dihydronaphthalene;1,3-thiazole |
| SMILES | C1=Cc2ccccc2CC1.c1cscn1 |
| InChI | InChI=1S/C10H10.C3H3NS/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-5-3-4-1/h1-3,5-7H,4,8H2;1-3H |
| InChIKey | SYNUKIJUURZJAE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dihydronaphthalene;1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydronaphthalene;1,3-thiazole?
The IUPAC name of 1,2-dihydronaphthalene;1,3-thiazole (CID 68836302) is 1,2-dihydronaphthalene;1,3-thiazole.
What is the SMILES notation for 1,2-dihydronaphthalene;1,3-thiazole?
The canonical SMILES for 1,2-dihydronaphthalene;1,3-thiazole is C1=Cc2ccccc2CC1.c1cscn1.
What is the InChIKey of 1,2-dihydronaphthalene;1,3-thiazole?
The InChIKey is SYNUKIJUURZJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10.C3H3NS/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-5-3-4-1/h1-3,5-7H,4,8H2;1-3H.
What are the key properties of 1,2-dihydronaphthalene;1,3-thiazole?
1,2-dihydronaphthalene;1,3-thiazole has a molecular weight of 215.32 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydronaphthalene;1,3-thiazole is sourced from PubChem (CID 68836302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).