C13H13NS — CID 68836302
1,2-dihydronaphthalene;1,3-thiazole (PubChem CID 68836302) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is 1,2-dihydronaphthalene;1,3-thiazole.
| Compound Name | 1,2-dihydronaphthalene;1,3-thiazole |
|---|---|
| PubChem CID | 68836302 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 1,2-dihydronaphthalene;1,3-thiazole |
| SMILES | C1=Cc2ccccc2CC1.c1cscn1 |
| InChI | InChI=1S/C10H10.C3H3NS/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-5-3-4-1/h1-3,5-7H,4,8H2;1-3H |
| InChIKey | SYNUKIJUURZJAE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |