C15H13N — CID 167682943
6-azatricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,10,12,14-heptaene (PubChem CID 167682943) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is 6-azatricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,10,12,14-heptaene.
| Compound Name | 6-azatricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,10,12,14-heptaene |
|---|---|
| PubChem CID | 167682943 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 6-azatricyclo[10.4.0.04,9]hexadeca-1(16),4(9),5,7,10,12,14-heptaene |
| SMILES | C1=Cc2ccncc2CCc2ccccc21 |
| InChI | InChI=1S/C15H13N/c1-2-4-13-7-8-15-11-16-10-9-14(15)6-5-12(13)3-1/h1-6,9-11H,7-8H2 |
| InChIKey | ZBDCEIAPHQSASC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |