C13H19N — CID 124705366
2-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-ethylethanamine (PubChem CID 124705366) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-ethylethanamine.
| Compound Name | 2-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 124705366 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-ethylethanamine |
| SMILES | CCNCC[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C13H19N/c1-2-14-10-9-12-8-7-11-5-3-4-6-13(11)12/h3-6,12,14H,2,7-10H2,1H3/t12-/m0/s1 |
| InChIKey | PGYBCRKBLYYOST-LBPRGKRZSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|