C17H25N — CID 79590299
N-ethyl-5-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-3-en-1-amine (PubChem CID 79590299) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is N-ethyl-5-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-3-en-1-amine.
| Compound Name | N-ethyl-5-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 79590299 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N-ethyl-5-(1,2,3,4-tetrahydronaphthalen-1-yl)pent-3-en-1-amine |
| SMILES | CCNCCC=CCC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H25N/c1-2-18-14-7-3-4-9-15-11-8-12-16-10-5-6-13-17(15)16/h3-6,10,13,15,18H,2,7-9,11-12,14H2,1H3 |
| InChIKey | BPKKRDPYHSHICU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|