C13H18BrN — CID 114505328
2-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)ethanamine (PubChem CID 114505328) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 2-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)ethanamine.
| Compound Name | 2-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 114505328 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)ethanamine |
| SMILES | BrCCNCC1CCCc2ccccc21 |
| InChI | InChI=1S/C13H18BrN/c14-8-9-15-10-12-6-3-5-11-4-1-2-7-13(11)12/h1-2,4,7,12,15H,3,5-6,8-10H2 |
| InChIKey | SGAVPUJYKSQDOT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|