C17H26ClN — CID 107845672
6-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)hexan-1-amine (PubChem CID 107845672) has the molecular formula C17H26ClN and a molecular weight of 279.86 g/mol. Its IUPAC name is 6-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)hexan-1-amine.
| Compound Name | 6-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)hexan-1-amine |
|---|---|
| PubChem CID | 107845672 |
| Molecular Formula | C17H26ClN |
| Molecular Weight | 279.86 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 6-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)hexan-1-amine |
| SMILES | ClCCCCCCNCC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H26ClN/c18-12-5-1-2-6-13-19-14-16-10-7-9-15-8-3-4-11-17(15)16/h3-4,8,11,16,19H,1-2,5-7,9-10,12-14H2 |
| InChIKey | AECRIKLMSXOSTJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.86 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|