C18H26ClN — CID 106123359
1-(4-chlorocyclohexyl)-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)methanamine (PubChem CID 106123359) has the molecular formula C18H26ClN and a molecular weight of 291.87 g/mol. Its IUPAC name is 1-(4-chlorocyclohexyl)-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)methanamine.
| Compound Name | 1-(4-chlorocyclohexyl)-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)methanamine |
|---|---|
| PubChem CID | 106123359 |
| Molecular Formula | C18H26ClN |
| Molecular Weight | 291.87 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-(4-chlorocyclohexyl)-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)methanamine |
| SMILES | ClC1CCC(CNCC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C18H26ClN/c19-17-10-8-14(9-11-17)12-20-13-16-6-3-5-15-4-1-2-7-18(15)16/h1-2,4,7,14,16-17,20H,3,5-6,8-13H2 |
| InChIKey | WRPHYPMGLUYPRI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|