C16H24ClN — CID 113496280
1-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)pentan-3-amine (PubChem CID 113496280) has the molecular formula C16H24ClN and a molecular weight of 265.83 g/mol. Its IUPAC name is 1-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)pentan-3-amine.
| Compound Name | 1-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)pentan-3-amine |
|---|---|
| PubChem CID | 113496280 |
| Molecular Formula | C16H24ClN |
| Molecular Weight | 265.83 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-chloro-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)pentan-3-amine |
| SMILES | CCC(CCCl)NCC1CCCc2ccccc21 |
| InChI | InChI=1S/C16H24ClN/c1-2-15(10-11-17)18-12-14-8-5-7-13-6-3-4-9-16(13)14/h3-4,6,9,14-15,18H,2,5,7-8,10-12H2,1H3 |
| InChIKey | IBNOBYMSLOESBY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|