C15H22BrN — CID 83188117
4-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)butan-2-amine (PubChem CID 83188117) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 4-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)butan-2-amine.
| Compound Name | 4-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 83188117 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 4-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)butan-2-amine |
| SMILES | CC(CCBr)NCC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H22BrN/c1-12(9-10-16)17-11-14-7-4-6-13-5-2-3-8-15(13)14/h2-3,5,8,12,14,17H,4,6-7,9-11H2,1H3 |
| InChIKey | BIJFNTVPIGWDEU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|