C15H19N — CID 114416758
N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)but-3-yn-2-amine (PubChem CID 114416758) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)but-3-yn-2-amine.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)but-3-yn-2-amine |
|---|---|
| PubChem CID | 114416758 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)but-3-yn-2-amine |
| SMILES | C#CC(C)NCC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H19N/c1-3-12(2)16-11-14-9-6-8-13-7-4-5-10-15(13)14/h1,4-5,7,10,12,14,16H,6,8-9,11H2,2H3 |
| InChIKey | WJGPPEOACKRJMO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|