C11H13Br — CID 13067239
1-(bromomethyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 13067239) has the molecular formula C11H13Br and a molecular weight of 225.13 g/mol. Its IUPAC name is 1-(bromomethyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(bromomethyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 13067239 |
| Molecular Formula | C11H13Br |
| Molecular Weight | 225.13 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 1-(bromomethyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | BrCC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H13Br/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-2,4,7,10H,3,5-6,8H2 |
| InChIKey | KALOJGOUZQSEGH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|