C15H21Cl — CID 10561836
1-(5-chloropentyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 10561836) has the molecular formula C15H21Cl and a molecular weight of 236.79 g/mol. Its IUPAC name is 1-(5-chloropentyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(5-chloropentyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 10561836 |
| Molecular Formula | C15H21Cl |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(5-chloropentyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | ClCCCCCC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H21Cl/c16-12-5-1-2-7-13-9-6-10-14-8-3-4-11-15(13)14/h3-4,8,11,13H,1-2,5-7,9-10,12H2 |
| InChIKey | DIAFTNBHRLGWMX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|