C14H20O3S — CID 142978184
4-(1,2,3,4-tetrahydronaphthalen-1-yl)butane-1-sulfonic acid (PubChem CID 142978184) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydronaphthalen-1-yl)butane-1-sulfonic acid.
| Compound Name | 4-(1,2,3,4-tetrahydronaphthalen-1-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 142978184 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-(1,2,3,4-tetrahydronaphthalen-1-yl)butane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCC1CCCc2ccccc21 |
| InChI | InChI=1S/C14H20O3S/c15-18(16,17)11-4-3-7-13-9-5-8-12-6-1-2-10-14(12)13/h1-2,6,10,13H,3-5,7-9,11H2,(H,15,16,17) |
| InChIKey | ALMNJETVVVLOHQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|