C16H24O3S — CID 71384670
8-hexyl-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid (PubChem CID 71384670) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is 8-hexyl-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid.
| Compound Name | 8-hexyl-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 71384670 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 8-hexyl-5,6,7,8-tetrahydronaphthalene-2-sulfonic acid |
| SMILES | CCCCCCC1CCCc2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C16H24O3S/c1-2-3-4-5-7-13-8-6-9-14-10-11-15(12-16(13)14)20(17,18)19/h10-13H,2-9H2,1H3,(H,17,18,19) |
| InChIKey | QSMDXIDVLYJSMI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|