C11H14O3S — CID 175738988
7-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 175738988) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is 7-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 7-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 175738988 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 7-methylsulfonyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C(O)CCC2 |
| InChI | InChI=1S/C11H14O3S/c1-15(13,14)9-6-5-8-3-2-4-11(12)10(8)7-9/h5-7,11-12H,2-4H2,1H3 |
| InChIKey | KBUQDRQORFOQII-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |