About 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile
8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 57278272) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
Analyze 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile?
The IUPAC name of 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (CID 57278272) is 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
What is the SMILES notation for 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile?
The canonical SMILES for 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile is N#Cc1ccc2c(c1)C(O)CCC2.
What is the InChIKey of 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile?
The InChIKey is DJMOULGYUXBTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c12-7-8-4-5-9-2-1-3-11(13)10(9)6-8/h4-6,11,13H,1-3H2.
What are the key properties of 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile?
8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile has a molecular weight of 173.22 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carbonitrile is sourced from PubChem (CID 57278272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).