C16H16O3S — CID 59850114
(1R)-6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 59850114) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is (1R)-6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R)-6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 59850114 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (1R)-6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | O=S(=O)(c1ccccc1)c1ccc2c(c1)CCC[C@H]2O |
| InChI | InChI=1S/C16H16O3S/c17-16-8-4-5-12-11-14(9-10-15(12)16)20(18,19)13-6-2-1-3-7-13/h1-3,6-7,9-11,16-17H,4-5,8H2/t16-/m1/s1 |
| InChIKey | NYMJBWLZLFBQLX-MRXNPFEDSA-N |
| XLogP | 2.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |