C11H12O4S — CID 70832765
6-methylsulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 70832765) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is 6-methylsulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid.
| Compound Name | 6-methylsulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid |
|---|---|
| PubChem CID | 70832765 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 6-methylsulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc2c(c1)C(C(=O)O)CC2 |
| InChI | InChI=1S/C11H12O4S/c1-16(14,15)8-4-2-7-3-5-9(11(12)13)10(7)6-8/h2,4,6,9H,3,5H2,1H3,(H,12,13) |
| InChIKey | GVCNLOQWEMHUHS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |