C24H28F2N2O5S — CID 67045789
6-[4-[4-(difluoromethoxy)-3-methylphenyl]-2,6-dimethylpiperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 67045789) has the molecular formula C24H28F2N2O5S and a molecular weight of 494.56 g/mol. Its IUPAC name is 6-[4-[4-(difluoromethoxy)-3-methylphenyl]-2,6-dimethylpiperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid.
| Compound Name | 6-[4-[4-(difluoromethoxy)-3-methylphenyl]-2,6-dimethylpiperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid |
|---|---|
| PubChem CID | 67045789 |
| Molecular Formula | C24H28F2N2O5S |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 6-[4-[4-(difluoromethoxy)-3-methylphenyl]-2,6-dimethylpiperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid |
| SMILES | Cc1cc(N2CC(C)N(S(=O)(=O)c3ccc4c(c3)C(C(=O)O)CC4)C(C)C2)ccc1OC(F)F |
| InChI | InChI=1S/C24H28F2N2O5S/c1-14-10-18(6-9-22(14)33-24(25)26)27-12-15(2)28(16(3)13-27)34(31,32)19-7-4-17-5-8-20(23(29)30)21(17)11-19/h4,6-7,9-11,15-16,20,24H,5,8,12-13H2,1-3H3,(H,29,30) |
| InChIKey | SWVPKHAFZJSNJV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|