C23H25F3N2O5S — CID 67045752
6-[2,6-dimethyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid (PubChem CID 67045752) has the molecular formula C23H25F3N2O5S and a molecular weight of 498.52 g/mol. Its IUPAC name is 6-[2,6-dimethyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid.
| Compound Name | 6-[2,6-dimethyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid |
|---|---|
| PubChem CID | 67045752 |
| Molecular Formula | C23H25F3N2O5S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 6-[2,6-dimethyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carboxylic acid |
| SMILES | CC1CN(c2ccc(OC(F)(F)F)cc2)CC(C)N1S(=O)(=O)c1ccc2c(c1)C(C(=O)O)CC2 |
| InChI | InChI=1S/C23H25F3N2O5S/c1-14-12-27(17-5-7-18(8-6-17)33-23(24,25)26)13-15(2)28(14)34(31,32)19-9-3-16-4-10-20(22(29)30)21(16)11-19/h3,5-9,11,14-15,20H,4,10,12-13H2,1-2H3,(H,29,30) |
| InChIKey | MNGGHHBFOJTBCR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|