C22H25F3N2O5S — CID 162581558
2-[5-[2,2-dimethyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2-methylphenyl]acetic acid (PubChem CID 162581558) has the molecular formula C22H25F3N2O5S and a molecular weight of 486.51 g/mol. Its IUPAC name is 2-[5-[2,2-dimethyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2-methylphenyl]acetic acid.
| Compound Name | 2-[5-[2,2-dimethyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2-methylphenyl]acetic acid |
|---|---|
| PubChem CID | 162581558 |
| Molecular Formula | C22H25F3N2O5S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-[5-[2,2-dimethyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2-methylphenyl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3ccc(OC(F)(F)F)cc3)CC2(C)C)cc1CC(=O)O |
| InChI | InChI=1S/C22H25F3N2O5S/c1-15-4-9-19(12-16(15)13-20(28)29)33(30,31)27-11-10-26(14-21(27,2)3)17-5-7-18(8-6-17)32-22(23,24)25/h4-9,12H,10-11,13-14H2,1-3H3,(H,28,29) |
| InChIKey | NCLMXVPPVPQBCL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|