C20H24ClN3O4S — CID 139009484
5-[4-(4-chlorophenyl)-2,2-dimethylpiperazin-1-yl]sulfonyl-2-methoxybenzamide (PubChem CID 139009484) has the molecular formula C20H24ClN3O4S and a molecular weight of 437.95 g/mol. Its IUPAC name is 5-[4-(4-chlorophenyl)-2,2-dimethylpiperazin-1-yl]sulfonyl-2-methoxybenzamide.
| Compound Name | 5-[4-(4-chlorophenyl)-2,2-dimethylpiperazin-1-yl]sulfonyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 139009484 |
| Molecular Formula | C20H24ClN3O4S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 5-[4-(4-chlorophenyl)-2,2-dimethylpiperazin-1-yl]sulfonyl-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ccc(Cl)cc3)CC2(C)C)cc1C(N)=O |
| InChI | InChI=1S/C20H24ClN3O4S/c1-20(2)13-23(15-6-4-14(21)5-7-15)10-11-24(20)29(26,27)16-8-9-18(28-3)17(12-16)19(22)25/h4-9,12H,10-11,13H2,1-3H3,(H2,22,25) |
| InChIKey | GYEJLFSAGUYGHR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |