C14H20N2O5S — CID 146024510
5-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-methoxybenzamide (PubChem CID 146024510) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-methoxybenzamide.
| Compound Name | 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 146024510 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2(C)C)cc1C(N)=O |
| InChI | InChI=1S/C14H20N2O5S/c1-14(2)9-21-7-6-16(14)22(18,19)10-4-5-12(20-3)11(8-10)13(15)17/h4-5,8H,6-7,9H2,1-3H3,(H2,15,17) |
| InChIKey | CFAXAJOXFNOJBS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |