C14H16F3NO5S — CID 146132870
4-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-(trifluoromethyl)benzoic acid (PubChem CID 146132870) has the molecular formula C14H16F3NO5S and a molecular weight of 367.35 g/mol. Its IUPAC name is 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 146132870 |
| Molecular Formula | C14H16F3NO5S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-(trifluoromethyl)benzoic acid |
| SMILES | CC1(C)COCCN1S(=O)(=O)c1ccc(C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO5S/c1-13(2)8-23-6-5-18(13)24(21,22)9-3-4-10(12(19)20)11(7-9)14(15,16)17/h3-4,7H,5-6,8H2,1-2H3,(H,19,20) |
| InChIKey | FJEQHQJDQORRRD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |