C16H20N2O5S — CID 112507427
1-[4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]pyrrolidine-2,5-dione (PubChem CID 112507427) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 112507427 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-[4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]pyrrolidine-2,5-dione |
| SMILES | CC1(C)COCCN1S(=O)(=O)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-16(2)11-23-10-9-17(16)24(21,22)13-5-3-12(4-6-13)18-14(19)7-8-15(18)20/h3-6H,7-11H2,1-2H3 |
| InChIKey | XSSZVVZOCILXJQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|