C14H21NO4S — CID 61428098
1-[3-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]ethanol (PubChem CID 61428098) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 1-[3-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]ethanol.
| Compound Name | 1-[3-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]ethanol |
|---|---|
| PubChem CID | 61428098 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-[3-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]ethanol |
| SMILES | CC(O)c1cccc(S(=O)(=O)N2CCOCC2(C)C)c1 |
| InChI | InChI=1S/C14H21NO4S/c1-11(16)12-5-4-6-13(9-12)20(17,18)15-7-8-19-10-14(15,2)3/h4-6,9,11,16H,7-8,10H2,1-3H3 |
| InChIKey | WYMUNHHOJGJPHG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |