C13H17FN2O3S2 — CID 63289053
5-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-fluorobenzenecarbothioamide (PubChem CID 63289053) has the molecular formula C13H17FN2O3S2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-fluorobenzenecarbothioamide.
| Compound Name | 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 63289053 |
| Molecular Formula | C13H17FN2O3S2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-(3,3-dimethylmorpholin-4-yl)sulfonyl-2-fluorobenzenecarbothioamide |
| SMILES | CC1(C)COCCN1S(=O)(=O)c1ccc(F)c(C(N)=S)c1 |
| InChI | InChI=1S/C13H17FN2O3S2/c1-13(2)8-19-6-5-16(13)21(17,18)9-3-4-11(14)10(7-9)12(15)20/h3-4,7H,5-6,8H2,1-2H3,(H2,15,20) |
| InChIKey | GSYAOTLZPMCIQR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|