C14H20N2O3S2 — CID 106997855
4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3-methylbenzenecarbothioamide (PubChem CID 106997855) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3-methylbenzenecarbothioamide.
| Compound Name | 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 106997855 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3-methylbenzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)ccc1S(=O)(=O)N1CCOCC1(C)C |
| InChI | InChI=1S/C14H20N2O3S2/c1-10-8-11(13(15)20)4-5-12(10)21(17,18)16-6-7-19-9-14(16,2)3/h4-5,8H,6-7,9H2,1-3H3,(H2,15,20) |
| InChIKey | WQPFFLFDSUCOAQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|