C14H20N2O2S3 — CID 106998276
4-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-3-methylbenzenecarbothioamide (PubChem CID 106998276) has the molecular formula C14H20N2O2S3 and a molecular weight of 344.53 g/mol. Its IUPAC name is 4-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-3-methylbenzenecarbothioamide.
| Compound Name | 4-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 106998276 |
| Molecular Formula | C14H20N2O2S3 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-(2,6-dimethylthiomorpholin-4-yl)sulfonyl-3-methylbenzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)ccc1S(=O)(=O)N1CC(C)SC(C)C1 |
| InChI | InChI=1S/C14H20N2O2S3/c1-9-6-12(14(15)19)4-5-13(9)21(17,18)16-7-10(2)20-11(3)8-16/h4-6,10-11H,7-8H2,1-3H3,(H2,15,19) |
| InChIKey | SNBFZBRLZTWGQM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|