C14H23N3O3S — CID 107327901
[4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylphenyl]hydrazine (PubChem CID 107327901) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is [4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylphenyl]hydrazine.
| Compound Name | [4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylphenyl]hydrazine |
|---|---|
| PubChem CID | 107327901 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [4-(3,3-dimethylmorpholin-4-yl)sulfonyl-3,5-dimethylphenyl]hydrazine |
| SMILES | Cc1cc(NN)cc(C)c1S(=O)(=O)N1CCOCC1(C)C |
| InChI | InChI=1S/C14H23N3O3S/c1-10-7-12(16-15)8-11(2)13(10)21(18,19)17-5-6-20-9-14(17,3)4/h7-8,16H,5-6,9,15H2,1-4H3 |
| InChIKey | XGDWGINUGFSQHY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|