About [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol
[2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol (PubChem CID 107090677) has the molecular formula C13H18ClNO4S
and a molecular weight of 319.81 g/mol. Its IUPAC name is [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol.
Molecular Properties
| Compound Name | [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol |
| PubChem CID | 107090677 |
| Molecular Formula | C13H18ClNO4S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol |
| SMILES | CC1(C)COCCN1S(=O)(=O)c1ccc(CO)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO4S/c1-13(2)9-19-6-5-15(13)20(17,18)11-4-3-10(8-16)12(14)7-11/h3-4,7,16H,5-6,8-9H2,1-2H3 |
| InChIKey | OVPOGBINWNANGU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol?
The IUPAC name of [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol (CID 107090677) is [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol.
What is the SMILES notation for [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol?
The canonical SMILES for [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol is CC1(C)COCCN1S(=O)(=O)c1ccc(CO)c(Cl)c1.
What is the InChIKey of [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol?
The InChIKey is OVPOGBINWNANGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClNO4S/c1-13(2)9-19-6-5-15(13)20(17,18)11-4-3-10(8-16)12(14)7-11/h3-4,7,16H,5-6,8-9H2,1-2H3.
What are the key properties of [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol?
[2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol has a molecular weight of 319.81 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]methanol is sourced from PubChem (CID 107090677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).