C19H29N3O4S — CID 110352569
1-cyclohexyl-3-[4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]urea (PubChem CID 110352569) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]urea |
|---|---|
| PubChem CID | 110352569 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-cyclohexyl-3-[4-(3,3-dimethylmorpholin-4-yl)sulfonylphenyl]urea |
| SMILES | CC1(C)COCCN1S(=O)(=O)c1ccc(NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H29N3O4S/c1-19(2)14-26-13-12-22(19)27(24,25)17-10-8-16(9-11-17)21-18(23)20-15-6-4-3-5-7-15/h8-11,15H,3-7,12-14H2,1-2H3,(H2,20,21,23) |
| InChIKey | JOHBQYAAVNUOAW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |