C22H23F3N2O5S — CID 69071036
1-[(3S)-3-methyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydroindene-1-carboxylic acid (PubChem CID 69071036) has the molecular formula C22H23F3N2O5S and a molecular weight of 484.50 g/mol. Its IUPAC name is 1-[(3S)-3-methyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydroindene-1-carboxylic acid.
| Compound Name | 1-[(3S)-3-methyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydroindene-1-carboxylic acid |
|---|---|
| PubChem CID | 69071036 |
| Molecular Formula | C22H23F3N2O5S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-[(3S)-3-methyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydroindene-1-carboxylic acid |
| SMILES | C[C@H]1CN(S(=O)(=O)C2(C(=O)O)CCc3ccccc32)CCN1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H23F3N2O5S/c1-15-14-26(12-13-27(15)17-6-8-18(9-7-17)32-22(23,24)25)33(30,31)21(20(28)29)11-10-16-4-2-3-5-19(16)21/h2-9,15H,10-14H2,1H3,(H,28,29)/t15-,21?/m0/s1 |
| InChIKey | QQCAZKFOUGEOET-ZDGMYTEDSA-N |
| XLogP | 3.35 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|