C20H20CdO4 — CID 162540344
cadmium;bis(2,3-dihydro-1H-indene-1-carboxylic acid) (PubChem CID 162540344) has the molecular formula C20H20CdO4 and a molecular weight of 436.79 g/mol. Its IUPAC name is cadmium;bis(2,3-dihydro-1H-indene-1-carboxylic acid).
| Compound Name | cadmium;bis(2,3-dihydro-1H-indene-1-carboxylic acid) |
|---|---|
| PubChem CID | 162540344 |
| Molecular Formula | C20H20CdO4 |
| Molecular Weight | 436.79 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | cadmium;bis(2,3-dihydro-1H-indene-1-carboxylic acid) |
| SMILES | O=C(O)C1CCc2ccccc21.O=C(O)C1CCc2ccccc21.[Cd] |
| InChI | InChI=1S/2C10H10O2.Cd/c2*11-10(12)9-6-5-7-3-1-2-4-8(7)9;/h2*1-4,9H,5-6H2,(H,11,12); |
| InChIKey | HMFXYDPNYNRYOV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.79 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |