C15H20O2 — CID 71387603
5-(1,2,3,4-tetrahydronaphthalen-1-yl)pentanoic acid (PubChem CID 71387603) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 5-(1,2,3,4-tetrahydronaphthalen-1-yl)pentanoic acid.
| Compound Name | 5-(1,2,3,4-tetrahydronaphthalen-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 71387603 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 5-(1,2,3,4-tetrahydronaphthalen-1-yl)pentanoic acid |
| SMILES | O=C(O)CCCCC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H20O2/c16-15(17)11-4-2-7-13-9-5-8-12-6-1-3-10-14(12)13/h1,3,6,10,13H,2,4-5,7-9,11H2,(H,16,17) |
| InChIKey | XCHKGDUKWSDAAE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|