C14H22ClNO — CID 67867639
N-ethyl-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)ethanamine;hydrochloride (PubChem CID 67867639) has the molecular formula C14H22ClNO and a molecular weight of 255.79 g/mol. Its IUPAC name is N-ethyl-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)ethanamine;hydrochloride.
| Compound Name | N-ethyl-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 67867639 |
| Molecular Formula | C14H22ClNO |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-ethyl-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)ethanamine;hydrochloride |
| SMILES | CCNCCOC1CCCc2ccccc21.Cl |
| InChI | InChI=1S/C14H21NO.ClH/c1-2-15-10-11-16-14-9-5-7-12-6-3-4-8-13(12)14;/h3-4,6,8,14-15H,2,5,7,9-11H2,1H3;1H |
| InChIKey | VJTICXMFJBTSNO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|