C11H11O2- — CID 21310563
2-[(1R)-2,3-dihydro-1H-inden-1-yl]acetate (PubChem CID 21310563) has the molecular formula C11H11O2- and a molecular weight of 175.21 g/mol. Its IUPAC name is 2-[(1R)-2,3-dihydro-1H-inden-1-yl]acetate.
| Compound Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]acetate |
|---|---|
| PubChem CID | 21310563 |
| Molecular Formula | C11H11O2- |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]acetate |
| SMILES | O=C([O-])C[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C11H12O2/c12-11(13)7-9-6-5-8-3-1-2-4-10(8)9/h1-4,9H,5-7H2,(H,12,13)/p-1/t9-/m1/s1 |
| InChIKey | RJVZEPWRJJBXLH-SECBINFHSA-M |
| XLogP | 0.86 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |