C18H18BrNO — CID 86955694
N-[(4-bromophenyl)methyl]-2-(2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 86955694) has the molecular formula C18H18BrNO and a molecular weight of 344.25 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-2-(2,3-dihydro-1H-inden-1-yl)acetamide.
| Compound Name | N-[(4-bromophenyl)methyl]-2-(2,3-dihydro-1H-inden-1-yl)acetamide |
|---|---|
| PubChem CID | 86955694 |
| Molecular Formula | C18H18BrNO |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-2-(2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | O=C(CC1CCc2ccccc21)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrNO/c19-16-9-5-13(6-10-16)12-20-18(21)11-15-8-7-14-3-1-2-4-17(14)15/h1-6,9-10,15H,7-8,11-12H2,(H,20,21) |
| InChIKey | QFEJQJRTHYGXKI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |