C18H18ClNO — CID 24881783
N-benzyl-2-(6-chloro-2,3-dihydro-1H-inden-1-yl)acetamide (PubChem CID 24881783) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is N-benzyl-2-(6-chloro-2,3-dihydro-1H-inden-1-yl)acetamide.
| Compound Name | N-benzyl-2-(6-chloro-2,3-dihydro-1H-inden-1-yl)acetamide |
|---|---|
| PubChem CID | 24881783 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-benzyl-2-(6-chloro-2,3-dihydro-1H-inden-1-yl)acetamide |
| SMILES | O=C(CC1CCc2ccc(Cl)cc21)NCc1ccccc1 |
| InChI | InChI=1S/C18H18ClNO/c19-16-9-8-14-6-7-15(17(14)11-16)10-18(21)20-12-13-4-2-1-3-5-13/h1-5,8-9,11,15H,6-7,10,12H2,(H,20,21) |
| InChIKey | BILCBEALZXGESJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |