C11H14N2O — CID 15744568
2-(2,3-dihydro-1H-inden-1-yl)-N'-hydroxyethanimidamide (PubChem CID 15744568) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 15744568 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-yl)-N'-hydroxyethanimidamide |
| SMILES | N/C(CC1CCc2ccccc21)=N\O |
| InChI | InChI=1S/C11H14N2O/c12-11(13-14)7-9-6-5-8-3-1-2-4-10(8)9/h1-4,9,14H,5-7H2,(H2,12,13) |
| InChIKey | BKOAMIJKWDIZEN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|