C16H24IN3 — CID 119147501
1-cyclopentyl-2-(2,3-dihydro-1H-inden-1-ylmethyl)guanidine;hydroiodide (PubChem CID 119147501) has the molecular formula C16H24IN3 and a molecular weight of 385.29 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2,3-dihydro-1H-inden-1-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-(2,3-dihydro-1H-inden-1-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119147501 |
| Molecular Formula | C16H24IN3 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 1-cyclopentyl-2-(2,3-dihydro-1H-inden-1-ylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCc2ccccc21)NC1CCCC1 |
| InChI | InChI=1S/C16H23N3.HI/c17-16(19-14-6-2-3-7-14)18-11-13-10-9-12-5-1-4-8-15(12)13;/h1,4-5,8,13-14H,2-3,6-7,9-11H2,(H3,17,18,19);1H |
| InChIKey | CMJZYUFZHJXNFT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|