C12H14O2 — CID 129405873
[(1R)-2,3-dihydro-1H-inden-1-yl]methyl acetate (PubChem CID 129405873) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is [(1R)-2,3-dihydro-1H-inden-1-yl]methyl acetate.
| Compound Name | [(1R)-2,3-dihydro-1H-inden-1-yl]methyl acetate |
|---|---|
| PubChem CID | 129405873 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | [(1R)-2,3-dihydro-1H-inden-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H14O2/c1-9(13)14-8-11-7-6-10-4-2-3-5-12(10)11/h2-5,11H,6-8H2,1H3/t11-/m0/s1 |
| InChIKey | VAYKGAJKMOEXOC-NSHDSACASA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |