C17H23NO2 — CID 98348274
2-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-hydroxycyclohexyl)acetamide (PubChem CID 98348274) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-hydroxycyclohexyl)acetamide.
| Compound Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 98348274 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-(4-hydroxycyclohexyl)acetamide |
| SMILES | O=C(C[C@H]1CCc2ccccc21)NC1CCC(O)CC1 |
| InChI | InChI=1S/C17H23NO2/c19-15-9-7-14(8-10-15)18-17(20)11-13-6-5-12-3-1-2-4-16(12)13/h1-4,13-15,19H,5-11H2,(H,18,20)/t13-,14?,15?/m1/s1 |
| InChIKey | PDQZOZUGHOKEKS-WLYUNCDWSA-N |
| XLogP | 2.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |