C17H23NO2 — CID 91833981
2-(2,3-dihydro-1H-inden-2-yl)-N-(4-hydroxycyclohexyl)acetamide (PubChem CID 91833981) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-yl)-N-(4-hydroxycyclohexyl)acetamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-2-yl)-N-(4-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 91833981 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-yl)-N-(4-hydroxycyclohexyl)acetamide |
| SMILES | O=C(CC1Cc2ccccc2C1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C17H23NO2/c19-16-7-5-15(6-8-16)18-17(20)11-12-9-13-3-1-2-4-14(13)10-12/h1-4,12,15-16,19H,5-11H2,(H,18,20) |
| InChIKey | HRLUFDONVQWMLD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |