C22H30N2O6 — CID 171339015
formic acid;methyl 2-[[4-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]cyclohexanecarbonyl]amino]acetate (PubChem CID 171339015) has the molecular formula C22H30N2O6 and a molecular weight of 418.49 g/mol. Its IUPAC name is formic acid;methyl 2-[[4-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]cyclohexanecarbonyl]amino]acetate.
| Compound Name | formic acid;methyl 2-[[4-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]cyclohexanecarbonyl]amino]acetate |
|---|---|
| PubChem CID | 171339015 |
| Molecular Formula | C22H30N2O6 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | formic acid;methyl 2-[[4-[[2-(2,3-dihydro-1H-inden-1-yl)acetyl]amino]cyclohexanecarbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C1CCC(NC(=O)CC2CCc3ccccc32)CC1.O=CO |
| InChI | InChI=1S/C21H28N2O4.CH2O2/c1-27-20(25)13-22-21(26)15-8-10-17(11-9-15)23-19(24)12-16-7-6-14-4-2-3-5-18(14)16;2-1-3/h2-5,15-17H,6-13H2,1H3,(H,22,26)(H,23,24);1H,(H,2,3) |
| InChIKey | CLNFKZNDOQZWBF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|