C13H18N+ — CID 20656381
dimethyl-(4-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)azanium (PubChem CID 20656381) has the molecular formula C13H18N+ and a molecular weight of 188.29 g/mol. Its IUPAC name is dimethyl-(4-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)azanium.
| Compound Name | dimethyl-(4-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)azanium |
|---|---|
| PubChem CID | 20656381 |
| Molecular Formula | C13H18N+ |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | dimethyl-(4-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)azanium |
| SMILES | CC1CCC(=[N+](C)C)c2ccccc21 |
| InChI | InChI=1S/C13H18N/c1-10-8-9-13(14(2)3)12-7-5-4-6-11(10)12/h4-7,10H,8-9H2,1-3H3/q+1 |
| InChIKey | OFQGOWYVUKCITN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|